C10H12FN5O2S — CID 57249314
2-amino-9-[(2R,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione (PubChem CID 57249314) has the molecular formula C10H12FN5O2S and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-amino-9-[(2R,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione.
| Compound Name | 2-amino-9-[(2R,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione |
|---|---|
| PubChem CID | 57249314 |
| Molecular Formula | C10H12FN5O2S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-amino-9-[(2R,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione |
| SMILES | Nc1nc(=S)c2ncn([C@H]3CC(F)[C@@H](CO)O3)c2[nH]1 |
| InChI | InChI=1S/C10H12FN5O2S/c11-4-1-6(18-5(4)2-17)16-3-13-7-8(16)14-10(12)15-9(7)19/h3-6,17H,1-2H2,(H3,12,14,15,19)/t4?,5-,6-/m1/s1 |
| InChIKey | IFMOQROHIRWOLL-YSLANXFLSA-N |
| XLogP | 0.69 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|