C10H18N5O14P3S — CID 174547946
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione;diphosphono hydrogen phosphate (PubChem CID 174547946) has the molecular formula C10H18N5O14P3S and a molecular weight of 557.26 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione;diphosphono hydrogen phosphate.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione;diphosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174547946 |
| Molecular Formula | C10H18N5O14P3S |
| Molecular Weight | 557.26 g/mol |
| Exact Mass | 556.98 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione;diphosphono hydrogen phosphate |
| SMILES | Nc1nc(=S)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2[nH]1.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H13N5O4S.H5O10P3/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9;1-11(2,3)9-13(7,8)10-12(4,5)6/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,20);(H,7,8)(H2,1,2,3)(H2,4,5,6)/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | BYIDVOFHWWGDGL-GWTDSMLYSA-N |
| XLogP | -2.01 |
| TPSA | 313.26 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.26 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|