C10H18N5O18P3S — CID 174382146
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopurine-1-sulfonic acid;diphosphono hydrogen phosphate (PubChem CID 174382146) has the molecular formula C10H18N5O18P3S and a molecular weight of 621.26 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopurine-1-sulfonic acid;diphosphono hydrogen phosphate.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopurine-1-sulfonic acid;diphosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174382146 |
| Molecular Formula | C10H18N5O18P3S |
| Molecular Weight | 621.26 g/mol |
| Exact Mass | 620.96 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxopurine-1-sulfonic acid;diphosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1S(=O)(=O)O.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H13N5O8S.H5O10P3/c11-10-13-7-4(8(19)15(10)24(20,21)22)12-2-14(7)9-6(18)5(17)3(1-16)23-9;1-11(2,3)9-13(7,8)10-12(4,5)6/h2-3,5-6,9,16-18H,1H2,(H2,11,13)(H,20,21,22);(H,7,8)(H2,1,2,3)(H2,4,5,6)/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | ZZFSYWLDLDZIMU-GWTDSMLYSA-N |
| XLogP | -4.26 |
| TPSA | 373.84 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.26 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|