C22H30N10O10 — CID 158990241
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpurin-6-one (PubChem CID 158990241) has the molecular formula C22H30N10O10 and a molecular weight of 594.54 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpurin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpurin-6-one |
|---|---|
| PubChem CID | 158990241 |
| Molecular Formula | C22H30N10O10 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpurin-6-one |
| SMILES | Cn1c(N)nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1=O.Cn1c(N)nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/2C11H15N5O5/c2*1-15-9(20)5-8(14-11(15)12)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h2*3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14)/t2*4-,6-,7-,10-/m11/s1 |
| InChIKey | JQBKVAFAIHAQQG-VQFZJOCSSA-N |
| XLogP | -5.35 |
| TPSA | 297.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |