C12H15N5O6 — CID 102404057
2-amino-8-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpteridine-4,7-dione (PubChem CID 102404057) has the molecular formula C12H15N5O6 and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-amino-8-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpteridine-4,7-dione.
| Compound Name | 2-amino-8-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpteridine-4,7-dione |
|---|---|
| PubChem CID | 102404057 |
| Molecular Formula | C12H15N5O6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-amino-8-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpteridine-4,7-dione |
| SMILES | Cn1c(N)nc2c(ncc(=O)n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/C12H15N5O6/c1-16-10(22)6-9(15-12(16)13)17(5(19)2-14-6)11-8(21)7(20)4(3-18)23-11/h2,4,7-8,11,18,20-21H,3H2,1H3,(H2,13,15)/t4-,7-,8-,11-/m1/s1 |
| InChIKey | LMYOVWYVCCWPLK-TZQXKBMNSA-N |
| XLogP | -3.32 |
| TPSA | 165.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |