C10H12N5O7P — CID 57095844
2-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-phosphorosooxypurin-6-one (PubChem CID 57095844) has the molecular formula C10H12N5O7P and a molecular weight of 345.21 g/mol. Its IUPAC name is 2-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-phosphorosooxypurin-6-one.
| Compound Name | 2-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-phosphorosooxypurin-6-one |
|---|---|
| PubChem CID | 57095844 |
| Molecular Formula | C10H12N5O7P |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-phosphorosooxypurin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)C(O)C2O)c(=O)n1OP=O |
| InChI | InChI=1S/C10H12N5O7P/c11-10-13-7-4(8(19)15(10)22-23-20)12-2-14(7)9-6(18)5(17)3(1-16)21-9/h2-3,5-6,9,16-18H,1H2,(H2,11,13)/t3-,5?,6?,9-/m1/s1 |
| InChIKey | GYSWBJAGCMNZRF-VKJDSPIKSA-N |
| XLogP | -2.58 |
| TPSA | 174.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|