C16H14IN3O4 — CID 88971199
(2R,3R,4R,5R)-2-(4-amino-3-iodopyrrolo[2,3-b]pyridin-1-yl)-3-buta-1,3-diynyl-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 88971199) has the molecular formula C16H14IN3O4 and a molecular weight of 439.21 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(4-amino-3-iodopyrrolo[2,3-b]pyridin-1-yl)-3-buta-1,3-diynyl-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(4-amino-3-iodopyrrolo[2,3-b]pyridin-1-yl)-3-buta-1,3-diynyl-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 88971199 |
| Molecular Formula | C16H14IN3O4 |
| Molecular Weight | 439.21 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | (2R,3R,4R,5R)-2-(4-amino-3-iodopyrrolo[2,3-b]pyridin-1-yl)-3-buta-1,3-diynyl-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#CC#C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cc(I)c2c(N)ccnc21 |
| InChI | InChI=1S/C16H14IN3O4/c1-2-3-5-16(23)13(22)11(8-21)24-15(16)20-7-9(17)12-10(18)4-6-19-14(12)20/h1,4,6-7,11,13,15,21-23H,8H2,(H2,18,19)/t11-,13-,15-,16-/m1/s1 |
| InChIKey | VWOHHMDAVSCNGV-UIBBOPPKSA-N |
| XLogP | -0.16 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|