C14H17FN2O6 — CID 66555532
1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-(3-methylbuta-1,2-dienyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 66555532) has the molecular formula C14H17FN2O6 and a molecular weight of 328.30 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-(3-methylbuta-1,2-dienyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-(3-methylbuta-1,2-dienyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66555532 |
| Molecular Formula | C14H17FN2O6 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-(3-methylbuta-1,2-dienyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CC(C)=C=C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H17FN2O6/c1-7(2)3-4-14(22)10(19)9(6-18)23-12(14)17-5-8(15)11(20)16-13(17)21/h4-5,9-10,12,18-19,22H,6H2,1-2H3,(H,16,20,21)/t9-,10-,12-,14-/m1/s1 |
| InChIKey | YUCDSTQBPPOXSQ-BGOOENEXSA-N |
| XLogP | -1.22 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |