C9H10F3N2O7P — CID 175676207
[(2S,3R,5R)-4,4-difluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methylphosphonic acid (PubChem CID 175676207) has the molecular formula C9H10F3N2O7P and a molecular weight of 346.15 g/mol. Its IUPAC name is [(2S,3R,5R)-4,4-difluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methylphosphonic acid.
| Compound Name | [(2S,3R,5R)-4,4-difluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 175676207 |
| Molecular Formula | C9H10F3N2O7P |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | [(2S,3R,5R)-4,4-difluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methylphosphonic acid |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CP(=O)(O)O)[C@@H](O)C2(F)F)cc1F |
| InChI | InChI=1S/C9H10F3N2O7P/c10-3-1-14(8(17)13-6(3)16)7-9(11,12)5(15)4(21-7)2-22(18,19)20/h1,4-5,7,15H,2H2,(H,13,16,17)(H2,18,19,20)/t4-,5-,7-/m1/s1 |
| InChIKey | ZKQIKLZYEIMIBO-WYDQCIBASA-N |
| XLogP | -1.25 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|