C9H8BrClF2N2O4 — CID 121487405
5-bromo-1-[(2R,4R,5S)-5-(chloromethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 121487405) has the molecular formula C9H8BrClF2N2O4 and a molecular weight of 361.53 g/mol. Its IUPAC name is 5-bromo-1-[(2R,4R,5S)-5-(chloromethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(2R,4R,5S)-5-(chloromethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121487405 |
| Molecular Formula | C9H8BrClF2N2O4 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 5-bromo-1-[(2R,4R,5S)-5-(chloromethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CCl)[C@@H](O)C2(F)F)cc1Br |
| InChI | InChI=1S/C9H8BrClF2N2O4/c10-3-2-15(8(18)14-6(3)17)7-9(12,13)5(16)4(1-11)19-7/h2,4-5,7,16H,1H2,(H,14,17,18)/t4-,5-,7-/m1/s1 |
| InChIKey | NMVQFCQYVKNJRF-WYDQCIBASA-N |
| XLogP | 0.43 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|