C12H11F3N2O6 — CID 66555359
1-[(2R,3R,4R,5R)-3-(3,3-difluoropropa-1,2-dienyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 66555359) has the molecular formula C12H11F3N2O6 and a molecular weight of 336.22 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-(3,3-difluoropropa-1,2-dienyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3-(3,3-difluoropropa-1,2-dienyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66555359 |
| Molecular Formula | C12H11F3N2O6 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-(3,3-difluoropropa-1,2-dienyl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@]2(O)C=C=C(F)F)cc1F |
| InChI | InChI=1S/C12H11F3N2O6/c13-5-3-17(11(21)16-9(5)20)10-12(22,2-1-7(14)15)8(19)6(4-18)23-10/h2-3,6,8,10,18-19,22H,4H2,(H,16,20,21)/t6-,8-,10-,12-/m1/s1 |
| InChIKey | RXZZDZWRUCYRGA-VPZHOCMTSA-N |
| XLogP | -1.41 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |