C12H11F3N2O5 — CID 66555024
1-[(2R,3R,4R,5R)-3-(3,3-difluoropropa-1,2-dienyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 66555024) has the molecular formula C12H11F3N2O5 and a molecular weight of 320.22 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-(3,3-difluoropropa-1,2-dienyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3-(3,3-difluoropropa-1,2-dienyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66555024 |
| Molecular Formula | C12H11F3N2O5 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-(3,3-difluoropropa-1,2-dienyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@]2(F)C=C=C(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C12H11F3N2O5/c13-7(14)1-3-12(15)9(20)6(5-18)22-10(12)17-4-2-8(19)16-11(17)21/h2-4,6,9-10,18,20H,5H2,(H,16,19,21)/t6-,9-,10-,12-/m1/s1 |
| InChIKey | ZOWDRWJJXQZTFA-XYHAGOFUSA-N |
| XLogP | -0.57 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |