C11H14F2N2O5 — CID 69003717
5-fluoro-1-[(2S,3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 69003717) has the molecular formula C11H14F2N2O5 and a molecular weight of 292.24 g/mol. Its IUPAC name is 5-fluoro-1-[(2S,3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(2S,3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 69003717 |
| Molecular Formula | C11H14F2N2O5 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 5-fluoro-1-[(2S,3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@]1(O)[C@@H](CO)O[C@H](n2cc(F)c(=O)[nH]c2=O)[C@@]1(C)F |
| InChI | InChI=1S/C11H14F2N2O5/c1-10(13)8(20-6(4-16)11(10,2)19)15-3-5(12)7(17)14-9(15)18/h3,6,8,16,19H,4H2,1-2H3,(H,14,17,18)/t6-,8+,10-,11+/m1/s1 |
| InChIKey | DYIXWNOOBXEAIE-RXDXJJGDSA-N |
| XLogP | -0.96 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |