C13H17FN2O5 — CID 71527739
1-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 71527739) has the molecular formula C13H17FN2O5 and a molecular weight of 300.29 g/mol. Its IUPAC name is 1-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71527739 |
| Molecular Formula | C13H17FN2O5 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-[(3aS,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO)C[C@@H](n3cc(F)c(=O)[nH]c3=O)[C@@H]2O1 |
| InChI | InChI=1S/C13H17FN2O5/c1-13(2)20-9-6(5-17)3-8(10(9)21-13)16-4-7(14)11(18)15-12(16)19/h4,6,8-10,17H,3,5H2,1-2H3,(H,15,18,19)/t6-,8-,9-,10+/m1/s1 |
| InChIKey | QJRIPGQMQQSMDB-QQRDMOCMSA-N |
| XLogP | -0.25 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |