C15H22FN3O6 — CID 70375573
methyl 2-amino-3-[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-3,4-dimethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propanoate (PubChem CID 70375573) has the molecular formula C15H22FN3O6 and a molecular weight of 359.35 g/mol. Its IUPAC name is methyl 2-amino-3-[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-3,4-dimethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propanoate.
| Compound Name | methyl 2-amino-3-[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-3,4-dimethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 70375573 |
| Molecular Formula | C15H22FN3O6 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | methyl 2-amino-3-[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-3,4-dimethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propanoate |
| SMILES | COC(=O)C(N)C[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@](C)(F)[C@]1(C)O |
| InChI | InChI=1S/C15H22FN3O6/c1-7-6-19(13(22)18-10(7)20)12-14(2,16)15(3,23)9(25-12)5-8(17)11(21)24-4/h6,8-9,12,23H,5,17H2,1-4H3,(H,18,20,22)/t8?,9-,12-,14+,15-/m1/s1 |
| InChIKey | WBLALJDLJACUHY-CAIJBYDVSA-N |
| XLogP | -0.89 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |