C18H28N2O6Sn — CID 87797170
[[(2S,3R,4R,5R)-3-butoxy-4-butyl-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethylidene]tin (PubChem CID 87797170) has the molecular formula C18H28N2O6Sn and a molecular weight of 487.14 g/mol. Its IUPAC name is [[(2S,3R,4R,5R)-3-butoxy-4-butyl-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethylidene]tin.
| Compound Name | [[(2S,3R,4R,5R)-3-butoxy-4-butyl-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethylidene]tin |
|---|---|
| PubChem CID | 87797170 |
| Molecular Formula | C18H28N2O6Sn |
| Molecular Weight | 487.14 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | [[(2S,3R,4R,5R)-3-butoxy-4-butyl-4-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethylidene]tin |
| SMILES | CCCCO[C@@H]1[C@@H](C(O)=[Sn])O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@@]1(O)CCCC |
| InChI | InChI=1S/C18H28N2O6.Sn/c1-4-6-8-18(24)14(25-9-7-5-2)13(11-21)26-16(18)20-10-12(3)15(22)19-17(20)23;/h10,13-14,16,21,24H,4-9H2,1-3H3,(H,19,22,23);/t13-,14-,16-,18-;/m1./s1 |
| InChIKey | DUHSWOMQYSTNBI-YXCQCANPSA-N |
| XLogP | 0.52 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|