C18H30N2O6Sn — CID 173163408
[(2R,3R,4R,5R)-3,4-dibutoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-λ2-stannane (PubChem CID 173163408) has the molecular formula C18H30N2O6Sn and a molecular weight of 489.16 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibutoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-λ2-stannane.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibutoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-λ2-stannane |
|---|---|
| PubChem CID | 173163408 |
| Molecular Formula | C18H30N2O6Sn |
| Molecular Weight | 489.16 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibutoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-λ2-stannane |
| SMILES | CCCCO[C@@H]1[C@H](OCCCC)[C@@H](CO[SnH])O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H29N2O6.Sn.H/c1-4-6-8-24-14-13(11-21)26-17(15(14)25-9-7-5-2)20-10-12(3)16(22)19-18(20)23;;/h10,13-15,17H,4-9,11H2,1-3H3,(H,19,22,23);;/q-1;+1;/t13-,14-,15-,17-;;/m1../s1 |
| InChIKey | LJIJCNKCOOOWLL-YKZNYDHQSA-N |
| XLogP | 0.95 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|