C13H17IN2O6 — CID 146651607
(2R,3S,4S,5R)-3-iodo-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde (PubChem CID 146651607) has the molecular formula C13H17IN2O6 and a molecular weight of 424.19 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-iodo-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde.
| Compound Name | (2R,3S,4S,5R)-3-iodo-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 146651607 |
| Molecular Formula | C13H17IN2O6 |
| Molecular Weight | 424.19 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | (2R,3S,4S,5R)-3-iodo-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde |
| SMILES | COCCO[C@@H]1[C@H](I)[C@@H](C=O)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H17IN2O6/c1-7-5-16(13(19)15-11(7)18)12-10(21-4-3-20-2)9(14)8(6-17)22-12/h5-6,8-10,12H,3-4H2,1-2H3,(H,15,18,19)/t8-,9-,10-,12-/m1/s1 |
| InChIKey | COYRRQGZGYCQSC-DNRKLUKYSA-N |
| XLogP | -0.22 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|