C16H23N2O11P2-3 — CID 161284517
[4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-phosphonatocyclopropyl)oxolan-3-yl]oxy-methylphosphinate (PubChem CID 161284517) has the molecular formula C16H23N2O11P2-3 and a molecular weight of 481.31 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-phosphonatocyclopropyl)oxolan-3-yl]oxy-methylphosphinate.
| Compound Name | [4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-phosphonatocyclopropyl)oxolan-3-yl]oxy-methylphosphinate |
|---|---|
| PubChem CID | 161284517 |
| Molecular Formula | C16H23N2O11P2-3 |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | [4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(2-phosphonatocyclopropyl)oxolan-3-yl]oxy-methylphosphinate |
| SMILES | COCCOC1C(OP(C)(=O)[O-])C(C2CC2P(=O)([O-])[O-])OC1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H26N2O11P2/c1-8-7-18(16(20)17-14(8)19)15-13(27-5-4-26-2)12(29-30(3,21)22)11(28-15)9-6-10(9)31(23,24)25/h7,9-13,15H,4-6H2,1-3H3,(H,21,22)(H,17,19,20)(H2,23,24,25)/p-3 |
| InChIKey | VFNNTJCVNTURJF-UHFFFAOYSA-K |
| XLogP | -2.36 |
| TPSA | 195.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|