C16H25N2O11P2+ — CID 166464841
hydroperoxy-[2-[3-[hydroxy(methyl)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]cyclopropyl]-oxophosphanium (PubChem CID 166464841) has the molecular formula C16H25N2O11P2+ and a molecular weight of 483.33 g/mol. Its IUPAC name is hydroperoxy-[2-[3-[hydroxy(methyl)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]cyclopropyl]-oxophosphanium.
| Compound Name | hydroperoxy-[2-[3-[hydroxy(methyl)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]cyclopropyl]-oxophosphanium |
|---|---|
| PubChem CID | 166464841 |
| Molecular Formula | C16H25N2O11P2+ |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | hydroperoxy-[2-[3-[hydroxy(methyl)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]cyclopropyl]-oxophosphanium |
| SMILES | COCCOC1C(OP(C)(=O)O)C(C2CC2[P+](=O)OO)OC1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H24N2O11P2/c1-8-7-18(16(20)17-14(8)19)15-13(26-5-4-25-2)12(28-31(3,23)24)11(27-15)9-6-10(9)30(22)29-21/h7,9-13,15H,4-6H2,1-3H3,(H2-,17,19,20,21,23,24)/p+1 |
| InChIKey | FNBAERVLCHMYOE-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 175.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|