C16H26N2O11P2 — CID 163981865
[(E)-2-[(2R,3R,4R,5R)-3-[ethyl(hydroxy)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 163981865) has the molecular formula C16H26N2O11P2 and a molecular weight of 484.34 g/mol. Its IUPAC name is [(E)-2-[(2R,3R,4R,5R)-3-[ethyl(hydroxy)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2R,3R,4R,5R)-3-[ethyl(hydroxy)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 163981865 |
| Molecular Formula | C16H26N2O11P2 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | [(E)-2-[(2R,3R,4R,5R)-3-[ethyl(hydroxy)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | CCP(=O)(O)O[C@H]1[C@@H](OCCOC)[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1/C=C/P(=O)(O)O |
| InChI | InChI=1S/C16H26N2O11P2/c1-4-31(24,25)29-12-11(5-8-30(21,22)23)28-15(13(12)27-7-6-26-3)18-9-10(2)14(19)17-16(18)20/h5,8-9,11-13,15H,4,6-7H2,1-3H3,(H,24,25)(H,17,19,20)(H2,21,22,23)/b8-5+/t11-,12-,13-,15-/m1/s1 |
| InChIKey | SZCJOGXMVQCFRP-ZJGXCMELSA-N |
| XLogP | 0.06 |
| TPSA | 186.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|