C13H21N2O9P — CID 164835455
[(2S,4S,5R)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 164835455) has the molecular formula C13H21N2O9P and a molecular weight of 380.29 g/mol. Its IUPAC name is [(2S,4S,5R)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,4S,5R)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 164835455 |
| Molecular Formula | C13H21N2O9P |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [(2S,4S,5R)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COCCO[C@H]1C[C@@H](COP(=O)(O)O)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N2O9P/c1-8-6-15(13(17)14-11(8)16)12-10(22-4-3-21-2)5-9(24-12)7-23-25(18,19)20/h6,9-10,12H,3-5,7H2,1-2H3,(H,14,16,17)(H2,18,19,20)/t9-,10-,12+/m0/s1 |
| InChIKey | UKYCNDOQHBDAGF-JBLDHEPKSA-N |
| XLogP | -0.73 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|