C16H28N2O11P2 — CID 146384358
2-[(2R,4R,5R)-3-[hydroxy(methyl)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propylphosphonic acid (PubChem CID 146384358) has the molecular formula C16H28N2O11P2 and a molecular weight of 486.35 g/mol. Its IUPAC name is 2-[(2R,4R,5R)-3-[hydroxy(methyl)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propylphosphonic acid.
| Compound Name | 2-[(2R,4R,5R)-3-[hydroxy(methyl)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propylphosphonic acid |
|---|---|
| PubChem CID | 146384358 |
| Molecular Formula | C16H28N2O11P2 |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-[(2R,4R,5R)-3-[hydroxy(methyl)phosphoryl]oxy-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]propylphosphonic acid |
| SMILES | COCCO[C@@H]1C(OP(C)(=O)O)[C@@H](C(C)CP(=O)(O)O)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H28N2O11P2/c1-9-7-18(16(20)17-14(9)19)15-13(27-6-5-26-3)12(29-30(4,21)22)11(28-15)10(2)8-31(23,24)25/h7,10-13,15H,5-6,8H2,1-4H3,(H,21,22)(H,17,19,20)(H2,23,24,25)/t10?,11-,12?,13-,15-/m1/s1 |
| InChIKey | PFVLBQYINALAMS-KBZRWIBZSA-N |
| XLogP | -0.21 |
| TPSA | 186.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|