C12H17FN2O5 — CID 134348918
1-[(2R,3S,4R,5S)-3-fluoro-4,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 134348918) has the molecular formula C12H17FN2O5 and a molecular weight of 288.28 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5S)-3-fluoro-4,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5S)-3-fluoro-4,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134348918 |
| Molecular Formula | C12H17FN2O5 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[(2R,3S,4R,5S)-3-fluoro-4,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](CO)[C@@](C)(CO)[C@@H]2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17FN2O5/c1-6-3-15(11(19)14-9(6)18)10-8(13)12(2,5-17)7(4-16)20-10/h3,7-8,10,16-17H,4-5H2,1-2H3,(H,14,18,19)/t7-,8-,10-,12-/m1/s1 |
| InChIKey | CNIDLQNJMBMSQJ-FWSPBBIJSA-N |
| XLogP | -0.93 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |