C11H14N2O6 — CID 11242666
1-[(1R,2R,4S,5S)-1-hydroxy-2-(hydroxymethyl)-3,6-dioxabicyclo[3.2.0]heptan-4-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 11242666) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is 1-[(1R,2R,4S,5S)-1-hydroxy-2-(hydroxymethyl)-3,6-dioxabicyclo[3.2.0]heptan-4-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2R,4S,5S)-1-hydroxy-2-(hydroxymethyl)-3,6-dioxabicyclo[3.2.0]heptan-4-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11242666 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-[(1R,2R,4S,5S)-1-hydroxy-2-(hydroxymethyl)-3,6-dioxabicyclo[3.2.0]heptan-4-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2O[C@H](CO)[C@]3(O)CO[C@H]23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14N2O6/c1-5-2-13(10(16)12-8(5)15)9-7-11(17,4-18-7)6(3-14)19-9/h2,6-7,9,14,17H,3-4H2,1H3,(H,12,15,16)/t6-,7-,9+,11-/m1/s1 |
| InChIKey | VCZGUQTUCVBQKJ-JBBGHMQTSA-N |
| XLogP | -2.14 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |