C16H27FN2O5Si — CID 57210036
1-[(2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 57210036) has the molecular formula C16H27FN2O5Si and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57210036 |
| Molecular Formula | C16H27FN2O5Si |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](CO)[C@](O)([Si](C)(C)C(C)(C)C)[C@H]2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H27FN2O5Si/c1-9-7-19(14(22)18-12(9)21)13-11(17)16(23,10(8-20)24-13)25(5,6)15(2,3)4/h7,10-11,13,20,23H,8H2,1-6H3,(H,18,21,22)/t10-,11+,13-,16+/m1/s1 |
| InChIKey | FUWWPXHELSCUQU-WNCDQNTKSA-N |
| XLogP | 0.85 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|