C10H12N2O4 — CID 11042603
1-[(2R,5S)-5-(hydroxy(113C)methyl)-(2,3,4,5-13C4)2,5-dihydrofuran-2-yl]-5-methyl(613C,1,3-15N2)pyrimidine-2,4-dione (PubChem CID 11042603) has the molecular formula C10H12N2O4 and a molecular weight of 232.16 g/mol. Its IUPAC name is 1-[(2R,5S)-5-(hydroxy(113C)methyl)-(2,3,4,5-13C4)2,5-dihydrofuran-2-yl]-5-methyl(613C,1,3-15N2)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-(hydroxy(113C)methyl)-(2,3,4,5-13C4)2,5-dihydrofuran-2-yl]-5-methyl(613C,1,3-15N2)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11042603 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-[(2R,5S)-5-(hydroxy(113C)methyl)-(2,3,4,5-13C4)2,5-dihydrofuran-2-yl]-5-methyl(613C,1,3-15N2)pyrimidine-2,4-dione |
| SMILES | Cc1[13cH][15n]([13C@H]2[13CH]=[13CH][13C@@H]([13CH2]O)O2)c(=O)[15nH]c1=O |
| InChI | InChI=1S/C10H12N2O4/c1-6-4-12(10(15)11-9(6)14)8-3-2-7(5-13)16-8/h2-4,7-8,13H,5H2,1H3,(H,11,14,15)/t7-,8+/m0/s1/i2+1,3+1,4+1,5+1,7+1,8+1,11+1,12+1 |
| InChIKey | XNKLLVCARDGLGL-KUINUKATSA-N |
| XLogP | -0.71 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|