C10H11N2O5P — CID 134564739
5-methyl-1-[(2R,5S)-5-(phosphorosooxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione (PubChem CID 134564739) has the molecular formula C10H11N2O5P and a molecular weight of 270.18 g/mol. Its IUPAC name is 5-methyl-1-[(2R,5S)-5-(phosphorosooxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,5S)-5-(phosphorosooxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134564739 |
| Molecular Formula | C10H11N2O5P |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-methyl-1-[(2R,5S)-5-(phosphorosooxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C=C[C@@H](COP=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H11N2O5P/c1-6-4-12(10(14)11-9(6)13)8-3-2-7(17-8)5-16-18-15/h2-4,7-8H,5H2,1H3,(H,11,13,14)/t7-,8+/m0/s1 |
| InChIKey | NSKFGXPMQQWKBV-JGVFFNPUSA-N |
| XLogP | 0.52 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|