C14H21N2O7P — CID 101208050
tert-butyl [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl hydrogen phosphate (PubChem CID 101208050) has the molecular formula C14H21N2O7P and a molecular weight of 360.30 g/mol. Its IUPAC name is tert-butyl [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl hydrogen phosphate.
| Compound Name | tert-butyl [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 101208050 |
| Molecular Formula | C14H21N2O7P |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | tert-butyl [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C=C[C@@H](COP(=O)(O)OC(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H21N2O7P/c1-9-7-16(13(18)15-12(9)17)11-6-5-10(22-11)8-21-24(19,20)23-14(2,3)4/h5-7,10-11H,8H2,1-4H3,(H,19,20)(H,15,17,18)/t10-,11+/m0/s1 |
| InChIKey | QPUHWLZSTKBRSH-WDEREUQCSA-N |
| XLogP | 1.23 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|