C16H22N3O10P — CID 56849746
N,N-bis(2-methoxy-2-oxoethyl)-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphonamidic acid (PubChem CID 56849746) has the molecular formula C16H22N3O10P and a molecular weight of 447.34 g/mol. Its IUPAC name is N,N-bis(2-methoxy-2-oxoethyl)-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphonamidic acid.
| Compound Name | N,N-bis(2-methoxy-2-oxoethyl)-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphonamidic acid |
|---|---|
| PubChem CID | 56849746 |
| Molecular Formula | C16H22N3O10P |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N,N-bis(2-methoxy-2-oxoethyl)-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphonamidic acid |
| SMILES | COC(=O)CN(CC(=O)OC)P(=O)(O)OC[C@@H]1C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C16H22N3O10P/c1-10-6-19(16(23)17-15(10)22)12-5-4-11(29-12)9-28-30(24,25)18(7-13(20)26-2)8-14(21)27-3/h4-6,11-12H,7-9H2,1-3H3,(H,24,25)(H,17,22,23)/t11-,12+/m0/s1 |
| InChIKey | PQHNDAJLBXUFLJ-NWDGAFQWSA-N |
| XLogP | -0.94 |
| TPSA | 166.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|