C10H14N2O10P2 — CID 170224308
[(5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 170224308) has the molecular formula C10H14N2O10P2 and a molecular weight of 384.17 g/mol. Its IUPAC name is [(5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 170224308 |
| Molecular Formula | C10H14N2O10P2 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | [(5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C=CC(COP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O10P2/c1-6-4-12(10(14)11-9(6)13)8-3-2-7(21-8)5-20-24(18,19)22-23(15,16)17/h2-4,7-8H,5H2,1H3,(H,18,19)(H,11,13,14)(H2,15,16,17)/t7?,8-/m1/s1 |
| InChIKey | LXCAIISEDMYORY-BRFYHDHCSA-N |
| XLogP | -0.48 |
| TPSA | 177.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|