C26H36N4O13P2 — CID 164685932
[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-propan-2-yloxyphosphoryl] [(2R,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl propan-2-yl phosphate (PubChem CID 164685932) has the molecular formula C26H36N4O13P2 and a molecular weight of 674.54 g/mol. Its IUPAC name is [[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-propan-2-yloxyphosphoryl] [(2R,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl propan-2-yl phosphate.
| Compound Name | [[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-propan-2-yloxyphosphoryl] [(2R,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl propan-2-yl phosphate |
|---|---|
| PubChem CID | 164685932 |
| Molecular Formula | C26H36N4O13P2 |
| Molecular Weight | 674.54 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | [[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-propan-2-yloxyphosphoryl] [(2R,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl propan-2-yl phosphate |
| SMILES | Cc1cn([C@@H]2C=C[C@H](COP(=O)(OC(C)C)OP(=O)(OC[C@@H]3C=C[C@H](n4cc(C)c(=O)[nH]c4=O)O3)OC(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H36N4O13P2/c1-15(2)41-44(35,37-13-19-7-9-21(39-19)29-11-17(5)23(31)27-25(29)33)43-45(36,42-16(3)4)38-14-20-8-10-22(40-20)30-12-18(6)24(32)28-26(30)34/h7-12,15-16,19-22H,13-14H2,1-6H3,(H,27,31,33)(H,28,32,34)/t19-,20+,21+,22-,44?,45? |
| InChIKey | UNFNJOCHHBGHAK-JJXDYONMSA-N |
| XLogP | 2.73 |
| TPSA | 208.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|