C22H31N2O11PS2 — CID 169257075
acetylene;S-[2-[2-(3-hydroxypropanoylsulfanyl)ethoxy-[[(2S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxypropanethioate (PubChem CID 169257075) has the molecular formula C22H31N2O11PS2 and a molecular weight of 594.60 g/mol. Its IUPAC name is acetylene;S-[2-[2-(3-hydroxypropanoylsulfanyl)ethoxy-[[(2S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxypropanethioate.
| Compound Name | acetylene;S-[2-[2-(3-hydroxypropanoylsulfanyl)ethoxy-[[(2S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxypropanethioate |
|---|---|
| PubChem CID | 169257075 |
| Molecular Formula | C22H31N2O11PS2 |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | acetylene;S-[2-[2-(3-hydroxypropanoylsulfanyl)ethoxy-[[(2S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxypropanethioate |
| SMILES | C#C.Cc1cn(C2C=C[C@@H](COP(=O)(OCCSC(=O)CCO)OCCSC(=O)CCO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H29N2O11PS2.C2H2/c1-14-12-22(20(28)21-19(14)27)16-3-2-15(33-16)13-32-34(29,30-8-10-35-17(25)4-6-23)31-9-11-36-18(26)5-7-24;1-2/h2-3,12,15-16,23-24H,4-11,13H2,1H3,(H,21,27,28);1-2H/t15-,16?;/m0./s1 |
| InChIKey | YTIPIABDKVTNFB-VPVGQWTESA-N |
| XLogP | 0.99 |
| TPSA | 183.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|