C11H15N2O3P — CID 45113936
5-methyl-1-[(2R,5R)-5-(2-phosphanylethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione (PubChem CID 45113936) has the molecular formula C11H15N2O3P and a molecular weight of 254.23 g/mol. Its IUPAC name is 5-methyl-1-[(2R,5R)-5-(2-phosphanylethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,5R)-5-(2-phosphanylethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 45113936 |
| Molecular Formula | C11H15N2O3P |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-methyl-1-[(2R,5R)-5-(2-phosphanylethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C=C[C@@H](CCP)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N2O3P/c1-7-6-13(11(15)12-10(7)14)9-3-2-8(16-9)4-5-17/h2-3,6,8-9H,4-5,17H2,1H3,(H,12,14,15)/t8-,9+/m0/s1 |
| InChIKey | SSLPAJNDWICPDL-DTWKUNHWSA-N |
| XLogP | 0.56 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|