C17H18N2O4 — CID 139721718
5-methyl-1-[(5S)-5-(phenylmethoxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione (PubChem CID 139721718) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 5-methyl-1-[(5S)-5-(phenylmethoxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(5S)-5-(phenylmethoxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139721718 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 5-methyl-1-[(5S)-5-(phenylmethoxymethyl)-2,5-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn(C2C=C[C@@H](COCc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N2O4/c1-12-9-19(17(21)18-16(12)20)15-8-7-14(23-15)11-22-10-13-5-3-2-4-6-13/h2-9,14-15H,10-11H2,1H3,(H,18,20,21)/t14-,15?/m0/s1 |
| InChIKey | SNSDLPPCUMUZCU-MLCCFXAWSA-N |
| XLogP | 1.52 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|