C29H27FN2O7 — CID 57270079
5-fluoro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-trityloxan-2-yl]pyrimidine-2,4-dione (PubChem CID 57270079) has the molecular formula C29H27FN2O7 and a molecular weight of 534.54 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-trityloxan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-trityloxan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57270079 |
| Molecular Formula | C29H27FN2O7 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 5-fluoro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-trityloxan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@]2(O)C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C29H27FN2O7/c30-21-16-32(27(37)31-25(21)36)26-29(38,24(35)23(34)22(17-33)39-26)28(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-16,22-24,26,33-35,38H,17H2,(H,31,36,37)/t22-,23+,24+,26-,29-/m1/s1 |
| InChIKey | NKWZHRNKKIFGGQ-CIDGMFJHSA-N |
| XLogP | 1.05 |
| TPSA | 145.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|