C9H15FN2O8PS+ — CID 171529062
5-fluoro-1-[(5S)-5-hydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one;trihydroxy(hydroxymethoxy)phosphanium (PubChem CID 171529062) has the molecular formula C9H15FN2O8PS+ and a molecular weight of 361.26 g/mol. Its IUPAC name is 5-fluoro-1-[(5S)-5-hydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one;trihydroxy(hydroxymethoxy)phosphanium.
| Compound Name | 5-fluoro-1-[(5S)-5-hydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one;trihydroxy(hydroxymethoxy)phosphanium |
|---|---|
| PubChem CID | 171529062 |
| Molecular Formula | C9H15FN2O8PS+ |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 5-fluoro-1-[(5S)-5-hydroxyoxolan-2-yl]-2-sulfanylidenepyrimidin-4-one;trihydroxy(hydroxymethoxy)phosphanium |
| SMILES | O=c1[nH]c(=S)n(C2CC[C@@H](O)O2)cc1F.OCO[P+](O)(O)O |
| InChI | InChI=1S/C8H9FN2O3S.CH6O5P/c9-4-3-11(8(15)10-7(4)13)5-1-2-6(12)14-5;2-1-6-7(3,4)5/h3,5-6,12H,1-2H2,(H,10,13,15);2-5H,1H2/q;+1/t5?,6-;/m0./s1 |
| InChIKey | ZRYRYFRUQJYAAG-PQAGPIFVSA-N |
| XLogP | -0.72 |
| TPSA | 157.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|