C9H14BFN2O7PS+ — CID 171528932
CID 171528932 (PubChem CID 171528932) has the molecular formula C9H14BFN2O7PS+ and a molecular weight of 355.07 g/mol.
| Compound Name | CID 171528932 |
|---|---|
| PubChem CID | 171528932 |
| Molecular Formula | C9H14BFN2O7PS+ |
| Molecular Weight | 355.07 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(=S)c(F)cn1C1CC[C@@H](O)O1.[B]CO[P+](O)(O)O |
| InChI | InChI=1S/C8H9FN2O3S.CH5BO4P/c9-4-3-11(8(13)10-7(4)15)5-1-2-6(12)14-5;2-1-6-7(3,4)5/h3,5-6,12H,1-2H2,(H,10,13,15);3-5H,1H2/q;+1/t5?,6-;/m0./s1 |
| InChIKey | SXZUQTJNQLGBHM-PQAGPIFVSA-N |
| XLogP | -0.54 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.07 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|