C9H13ClN2O6PS+ — CID 156803950
[5-(5-chloro-2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-trihydroxyphosphanium (PubChem CID 156803950) has the molecular formula C9H13ClN2O6PS+ and a molecular weight of 343.71 g/mol. Its IUPAC name is [5-(5-chloro-2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-trihydroxyphosphanium.
| Compound Name | [5-(5-chloro-2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-trihydroxyphosphanium |
|---|---|
| PubChem CID | 156803950 |
| Molecular Formula | C9H13ClN2O6PS+ |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | [5-(5-chloro-2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-trihydroxyphosphanium |
| SMILES | O=c1[nH]c(=S)c(Cl)cn1C1CCC(CO[P+](O)(O)O)O1 |
| InChI | InChI=1S/C9H12ClN2O6PS/c10-6-3-12(9(13)11-8(6)20)7-2-1-5(18-7)4-17-19(14,15)16/h3,5,7,14-16H,1-2,4H2/p+1 |
| InChIKey | ZXAGVPRDNQEGTE-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|