C12H22N2O10P+ — CID 153342401
[5-(5-formyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-trihydroxyphosphanium;methanol (PubChem CID 153342401) has the molecular formula C12H22N2O10P+ and a molecular weight of 385.29 g/mol. Its IUPAC name is [5-(5-formyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-trihydroxyphosphanium;methanol.
| Compound Name | [5-(5-formyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-trihydroxyphosphanium;methanol |
|---|---|
| PubChem CID | 153342401 |
| Molecular Formula | C12H22N2O10P+ |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [5-(5-formyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-trihydroxyphosphanium;methanol |
| SMILES | CO.CO.O=Cc1cn(C2CCC(CO[P+](O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13N2O8P.2CH4O/c13-4-6-3-12(10(15)11-9(6)14)8-2-1-7(20-8)5-19-21(16,17)18;2*1-2/h3-4,7-8,16-18H,1-2,5H2;2*2H,1H3/p+1 |
| InChIKey | LUELCYGECUDUPD-UHFFFAOYSA-O |
| XLogP | -2.09 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|