C12H18N3O7P — CID 59806215
[(2S,5R)-5-[5-[(E)-3-aminoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 59806215) has the molecular formula C12H18N3O7P and a molecular weight of 347.26 g/mol. Its IUPAC name is [(2S,5R)-5-[5-[(E)-3-aminoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,5R)-5-[5-[(E)-3-aminoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59806215 |
| Molecular Formula | C12H18N3O7P |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | [(2S,5R)-5-[5-[(E)-3-aminoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC/C=C/c1cn([C@H]2CC[C@@H](COP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H18N3O7P/c13-5-1-2-8-6-15(12(17)14-11(8)16)10-4-3-9(22-10)7-21-23(18,19)20/h1-2,6,9-10H,3-5,7,13H2,(H,14,16,17)(H2,18,19,20)/b2-1+/t9-,10+/m0/s1 |
| InChIKey | HXRWRROMMAISDT-YBNRLKPGSA-N |
| XLogP | -0.70 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|