C10H14N2O6PS- — CID 164835448
1-[(2R,5S)-5-[[hydroxy(oxido)phosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 164835448) has the molecular formula C10H14N2O6PS- and a molecular weight of 321.27 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[hydroxy(oxido)phosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[hydroxy(oxido)phosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164835448 |
| Molecular Formula | C10H14N2O6PS- |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 1-[(2R,5S)-5-[[hydroxy(oxido)phosphinothioyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC[C@@H](COP([O-])(O)=S)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O6PS/c1-6-4-12(10(14)11-9(6)13)8-3-2-7(18-8)5-17-19(15,16)20/h4,7-8H,2-3,5H2,1H3,(H,11,13,14)(H2,15,16,20)/p-1/t7-,8+/m0/s1 |
| InChIKey | TZRCKZVQYGAZHW-JGVFFNPUSA-M |
| XLogP | -0.88 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|