C10H13AcFN2O3S — CID 59896367
actinium;1-[(2R,5R)-5-ethyl-3-hydroxyoxolan-2-yl]-5-fluoro-4-sulfanylidenepyrimidin-2-one (PubChem CID 59896367) has the molecular formula C10H13AcFN2O3S and a molecular weight of 487.29 g/mol. Its IUPAC name is actinium;1-[(2R,5R)-5-ethyl-3-hydroxyoxolan-2-yl]-5-fluoro-4-sulfanylidenepyrimidin-2-one.
| Compound Name | actinium;1-[(2R,5R)-5-ethyl-3-hydroxyoxolan-2-yl]-5-fluoro-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 59896367 |
| Molecular Formula | C10H13AcFN2O3S |
| Molecular Weight | 487.29 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | actinium;1-[(2R,5R)-5-ethyl-3-hydroxyoxolan-2-yl]-5-fluoro-4-sulfanylidenepyrimidin-2-one |
| SMILES | CC[C@@H]1CC(O)[C@H](n2cc(F)c(=S)[nH]c2=O)O1.[Ac] |
| InChI | InChI=1S/C10H13FN2O3S.Ac/c1-2-5-3-7(14)9(16-5)13-4-6(11)8(17)12-10(13)15;/h4-5,7,9,14H,2-3H2,1H3,(H,12,15,17);/t5-,7?,9-;/m1./s1 |
| InChIKey | BQANBLSFCYSIAN-YWCWLGIFSA-N |
| XLogP | 1.10 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|