C8H8BrFN2O2S — CID 23272221
1-[(2R,3R)-3-bromooxolan-2-yl]-5-fluoro-4-sulfanylidenepyrimidin-2-one (PubChem CID 23272221) has the molecular formula C8H8BrFN2O2S and a molecular weight of 295.13 g/mol. Its IUPAC name is 1-[(2R,3R)-3-bromooxolan-2-yl]-5-fluoro-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[(2R,3R)-3-bromooxolan-2-yl]-5-fluoro-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 23272221 |
| Molecular Formula | C8H8BrFN2O2S |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 1-[(2R,3R)-3-bromooxolan-2-yl]-5-fluoro-4-sulfanylidenepyrimidin-2-one |
| SMILES | O=c1[nH]c(=S)c(F)cn1[C@@H]1OCC[C@H]1Br |
| InChI | InChI=1S/C8H8BrFN2O2S/c9-4-1-2-14-7(4)12-3-5(10)6(15)11-8(12)13/h3-4,7H,1-2H2,(H,11,13,15)/t4-,7-/m1/s1 |
| InChIKey | MUXRRSREPRLZNG-CLZZGJSISA-N |
| XLogP | 1.73 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|