C8H7FN2O4 — CID 712433
5-fluoro-1-[(3S)-2-oxooxolan-3-yl]pyrimidine-2,4-dione (PubChem CID 712433) has the molecular formula C8H7FN2O4 and a molecular weight of 214.15 g/mol. Its IUPAC name is 5-fluoro-1-[(3S)-2-oxooxolan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(3S)-2-oxooxolan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 712433 |
| Molecular Formula | C8H7FN2O4 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 5-fluoro-1-[(3S)-2-oxooxolan-3-yl]pyrimidine-2,4-dione |
| SMILES | O=C1OCC[C@@H]1n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H7FN2O4/c9-4-3-11(8(14)10-6(4)12)5-1-2-15-7(5)13/h3,5H,1-2H2,(H,10,12,14)/t5-/m0/s1 |
| InChIKey | NRBFQWKKTTWGQQ-YFKPBYRVSA-N |
| XLogP | -0.84 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |