C8H8N2O3S — CID 23272220
1-(2-oxooxolan-3-yl)-4-sulfanylidenepyrimidin-2-one (PubChem CID 23272220) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is 1-(2-oxooxolan-3-yl)-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-(2-oxooxolan-3-yl)-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 23272220 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 1-(2-oxooxolan-3-yl)-4-sulfanylidenepyrimidin-2-one |
| SMILES | O=C1OCCC1n1ccc(=S)[nH]c1=O |
| InChI | InChI=1S/C8H8N2O3S/c11-7-5(2-4-13-7)10-3-1-6(14)9-8(10)12/h1,3,5H,2,4H2,(H,9,12,14) |
| InChIKey | QKOMQYBVPICYEQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|