C8H9N3O4 — CID 165482457
5-amino-1-(2-oxooxolan-3-yl)pyrimidine-2,4-dione (PubChem CID 165482457) has the molecular formula C8H9N3O4 and a molecular weight of 211.18 g/mol. Its IUPAC name is 5-amino-1-(2-oxooxolan-3-yl)pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-(2-oxooxolan-3-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 165482457 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 5-amino-1-(2-oxooxolan-3-yl)pyrimidine-2,4-dione |
| SMILES | Nc1cn(C2CCOC2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9N3O4/c9-4-3-11(8(14)10-6(4)12)5-1-2-15-7(5)13/h3,5H,1-2,9H2,(H,10,12,14) |
| InChIKey | CZLMBJBAVXHXHN-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |