C9H13N3O3 — CID 106929489
5-amino-1-(cyclopropylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 106929489) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-amino-1-(cyclopropylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-(cyclopropylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106929489 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-amino-1-(cyclopropylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | Nc1cn(COCC2CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O3/c10-7-3-12(9(14)11-8(7)13)5-15-4-6-1-2-6/h3,6H,1-2,4-5,10H2,(H,11,13,14) |
| InChIKey | GXMBJOJPEVRGAT-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |