C7H11N3O3 — CID 65277616
5-amino-1-(2-hydroxypropyl)pyrimidine-2,4-dione (PubChem CID 65277616) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 5-amino-1-(2-hydroxypropyl)pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-(2-hydroxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 65277616 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-amino-1-(2-hydroxypropyl)pyrimidine-2,4-dione |
| SMILES | CC(O)Cn1cc(N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H11N3O3/c1-4(11)2-10-3-5(8)6(12)9-7(10)13/h3-4,11H,2,8H2,1H3,(H,9,12,13) |
| InChIKey | JJBHAOHDIPHIAZ-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |