C8H13N3O4 — CID 165473870
5-amino-1-(2-methoxyethoxymethyl)pyrimidine-2,4-dione (PubChem CID 165473870) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 5-amino-1-(2-methoxyethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-(2-methoxyethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 165473870 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 5-amino-1-(2-methoxyethoxymethyl)pyrimidine-2,4-dione |
| SMILES | COCCOCn1cc(N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O4/c1-14-2-3-15-5-11-4-6(9)7(12)10-8(11)13/h4H,2-3,5,9H2,1H3,(H,10,12,13) |
| InChIKey | DSCSEPQZWZKGOT-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|